C15H15FN2O3 — CID 114351327
1-[(6-fluoroquinolin-8-yl)methyl]-4-hydroxypyrrolidine-2-carboxylic acid (PubChem CID 114351327) has the molecular formula C15H15FN2O3 and a molecular weight of 290.29 g/mol. Its IUPAC name is 1-[(6-fluoroquinolin-8-yl)methyl]-4-hydroxypyrrolidine-2-carboxylic acid.
| Compound Name | 1-[(6-fluoroquinolin-8-yl)methyl]-4-hydroxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 114351327 |
| Molecular Formula | C15H15FN2O3 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 1-[(6-fluoroquinolin-8-yl)methyl]-4-hydroxypyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CC(O)CN1Cc1cc(F)cc2cccnc12 |
| InChI | InChI=1S/C15H15FN2O3/c16-11-4-9-2-1-3-17-14(9)10(5-11)7-18-8-12(19)6-13(18)15(20)21/h1-5,12-13,19H,6-8H2,(H,20,21) |
| InChIKey | GJNWGXFADIQZQT-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |