About 3-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)benzoic acid
3-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)benzoic acid (PubChem CID 114351907) has the molecular formula C10H6N4O2S
and a molecular weight of 246.25 g/mol. Its IUPAC name is 3-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)benzoic acid.
Analyze 3-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)benzoic acid?
The IUPAC name of 3-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)benzoic acid (CID 114351907) is 3-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)benzoic acid.
What is the SMILES notation for 3-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)benzoic acid?
The canonical SMILES for 3-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)benzoic acid is O=C(O)c1cccc(-c2nn3cnnc3s2)c1.
What is the InChIKey of 3-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)benzoic acid?
The InChIKey is PBINQQMDUVXSHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N4O2S/c15-9(16)7-3-1-2-6(4-7)8-13-14-5-11-12-10(14)17-8/h1-5H,(H,15,16).
What are the key properties of 3-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)benzoic acid?
3-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)benzoic acid has a molecular weight of 246.25 g/mol, XLogP of 1.55, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)benzoic acid is sourced from PubChem (CID 114351907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).