C15H17N5OS — CID 50850363
N,N-diethyl-2-[3-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]acetamide (PubChem CID 50850363) has the molecular formula C15H17N5OS and a molecular weight of 315.40 g/mol. Its IUPAC name is N,N-diethyl-2-[3-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]acetamide.
| Compound Name | N,N-diethyl-2-[3-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 50850363 |
| Molecular Formula | C15H17N5OS |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | N,N-diethyl-2-[3-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]acetamide |
| SMILES | CCN(CC)C(=O)Cc1cccc(-c2nn3cnnc3s2)c1 |
| InChI | InChI=1S/C15H17N5OS/c1-3-19(4-2)13(21)9-11-6-5-7-12(8-11)14-18-20-10-16-17-15(20)22-14/h5-8,10H,3-4,9H2,1-2H3 |
| InChIKey | BFORXLNAOGCOIG-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 63.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |