C7H8F3N5S — CID 114351983
2,2,2-trifluoro-N-[(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)methyl]ethanamine (PubChem CID 114351983) has the molecular formula C7H8F3N5S and a molecular weight of 251.24 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)methyl]ethanamine.
| Compound Name | 2,2,2-trifluoro-N-[(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 114351983 |
| Molecular Formula | C7H8F3N5S |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 2,2,2-trifluoro-N-[(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)methyl]ethanamine |
| SMILES | Cc1nnc2sc(CNCC(F)(F)F)nn12 |
| InChI | InChI=1S/C7H8F3N5S/c1-4-12-13-6-15(4)14-5(16-6)2-11-3-7(8,9)10/h11H,2-3H2,1H3 |
| InChIKey | PTESTVKQFZVNLS-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |