C12H16F3N5S — CID 114353628
N-[(3-cyclohexyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)methyl]-2,2,2-trifluoroethanamine (PubChem CID 114353628) has the molecular formula C12H16F3N5S and a molecular weight of 319.36 g/mol. Its IUPAC name is N-[(3-cyclohexyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)methyl]-2,2,2-trifluoroethanamine.
| Compound Name | N-[(3-cyclohexyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)methyl]-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 114353628 |
| Molecular Formula | C12H16F3N5S |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | N-[(3-cyclohexyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)methyl]-2,2,2-trifluoroethanamine |
| SMILES | FC(F)(F)CNCc1nn2c(C3CCCCC3)nnc2s1 |
| InChI | InChI=1S/C12H16F3N5S/c13-12(14,15)7-16-6-9-19-20-10(17-18-11(20)21-9)8-4-2-1-3-5-8/h8,16H,1-7H2 |
| InChIKey | VSBGKJOYVACBGO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |