C12H17N5O2S2 — CID 114355897
N-[(3-cyclobutyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)methyl]-1,1-dioxothiolan-3-amine (PubChem CID 114355897) has the molecular formula C12H17N5O2S2 and a molecular weight of 327.44 g/mol. Its IUPAC name is N-[(3-cyclobutyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)methyl]-1,1-dioxothiolan-3-amine.
| Compound Name | N-[(3-cyclobutyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)methyl]-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 114355897 |
| Molecular Formula | C12H17N5O2S2 |
| Molecular Weight | 327.44 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | N-[(3-cyclobutyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)methyl]-1,1-dioxothiolan-3-amine |
| SMILES | O=S1(=O)CCC(NCc2nn3c(C4CCC4)nnc3s2)C1 |
| InChI | InChI=1S/C12H17N5O2S2/c18-21(19)5-4-9(7-21)13-6-10-16-17-11(8-2-1-3-8)14-15-12(17)20-10/h8-9,13H,1-7H2 |
| InChIKey | DOAITJCEMMXYCE-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.44 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |