C7H7ClN4S — CID 114355979
6-(chloromethyl)-3-cyclopropyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 114355979) has the molecular formula C7H7ClN4S and a molecular weight of 214.68 g/mol. Its IUPAC name is 6-(chloromethyl)-3-cyclopropyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 6-(chloromethyl)-3-cyclopropyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 114355979 |
| Molecular Formula | C7H7ClN4S |
| Molecular Weight | 214.68 g/mol |
| Exact Mass | 214.01 |
| IUPAC Name | 6-(chloromethyl)-3-cyclopropyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | ClCc1nn2c(C3CC3)nnc2s1 |
| InChI | InChI=1S/C7H7ClN4S/c8-3-5-11-12-6(4-1-2-4)9-10-7(12)13-5/h4H,1-3H2 |
| InChIKey | QQPMIFBBLGHLDI-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.68 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|