C14H15N5S — CID 114355737
2-(3-cyclobutyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-3-methylaniline (PubChem CID 114355737) has the molecular formula C14H15N5S and a molecular weight of 285.38 g/mol. Its IUPAC name is 2-(3-cyclobutyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-3-methylaniline.
| Compound Name | 2-(3-cyclobutyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-3-methylaniline |
|---|---|
| PubChem CID | 114355737 |
| Molecular Formula | C14H15N5S |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 2-(3-cyclobutyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-3-methylaniline |
| SMILES | Cc1cccc(N)c1-c1nn2c(C3CCC3)nnc2s1 |
| InChI | InChI=1S/C14H15N5S/c1-8-4-2-7-10(15)11(8)13-18-19-12(9-5-3-6-9)16-17-14(19)20-13/h2,4,7,9H,3,5-6,15H2,1H3 |
| InChIKey | ZDIULTWDRCHLTO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|