C12H10FN5S — CID 114354329
2-(3-cyclopropyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-3-fluoroaniline (PubChem CID 114354329) has the molecular formula C12H10FN5S and a molecular weight of 275.31 g/mol. Its IUPAC name is 2-(3-cyclopropyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-3-fluoroaniline.
| Compound Name | 2-(3-cyclopropyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-3-fluoroaniline |
|---|---|
| PubChem CID | 114354329 |
| Molecular Formula | C12H10FN5S |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 2-(3-cyclopropyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-3-fluoroaniline |
| SMILES | Nc1cccc(F)c1-c1nn2c(C3CC3)nnc2s1 |
| InChI | InChI=1S/C12H10FN5S/c13-7-2-1-3-8(14)9(7)11-17-18-10(6-4-5-6)15-16-12(18)19-11/h1-3,6H,4-5,14H2 |
| InChIKey | TZQORSGSRPFEJM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|