C13H12FN5S — CID 114355741
3-(3-cyclobutyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-4-fluoroaniline (PubChem CID 114355741) has the molecular formula C13H12FN5S and a molecular weight of 289.34 g/mol. Its IUPAC name is 3-(3-cyclobutyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-4-fluoroaniline.
| Compound Name | 3-(3-cyclobutyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-4-fluoroaniline |
|---|---|
| PubChem CID | 114355741 |
| Molecular Formula | C13H12FN5S |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 3-(3-cyclobutyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-4-fluoroaniline |
| SMILES | Nc1ccc(F)c(-c2nn3c(C4CCC4)nnc3s2)c1 |
| InChI | InChI=1S/C13H12FN5S/c14-10-5-4-8(15)6-9(10)12-18-19-11(7-2-1-3-7)16-17-13(19)20-12/h4-7H,1-3,15H2 |
| InChIKey | QQBQPJGDHFNALS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|