C7H3Br2ClO4S — CID 114356378
2,5-dibromo-3-chlorosulfonylbenzoic acid (PubChem CID 114356378) has the molecular formula C7H3Br2ClO4S and a molecular weight of 378.43 g/mol. Its IUPAC name is 2,5-dibromo-3-chlorosulfonylbenzoic acid.
| Compound Name | 2,5-dibromo-3-chlorosulfonylbenzoic acid |
|---|---|
| PubChem CID | 114356378 |
| Molecular Formula | C7H3Br2ClO4S |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 375.78 |
| IUPAC Name | 2,5-dibromo-3-chlorosulfonylbenzoic acid |
| SMILES | O=C(O)c1cc(Br)cc(S(=O)(=O)Cl)c1Br |
| InChI | InChI=1S/C7H3Br2ClO4S/c8-3-1-4(7(11)12)6(9)5(2-3)15(10,13)14/h1-2H,(H,11,12) |
| InChIKey | QLYNLXKTNIZAPR-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |