C16H28N2O — CID 114356505
3-amino-2-(N-ethyl-2-methylanilino)-4,4-dimethylpentan-1-ol (PubChem CID 114356505) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is 3-amino-2-(N-ethyl-2-methylanilino)-4,4-dimethylpentan-1-ol.
| Compound Name | 3-amino-2-(N-ethyl-2-methylanilino)-4,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 114356505 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | 3-amino-2-(N-ethyl-2-methylanilino)-4,4-dimethylpentan-1-ol |
| SMILES | CCN(c1ccccc1C)C(CO)C(N)C(C)(C)C |
| InChI | InChI=1S/C16H28N2O/c1-6-18(13-10-8-7-9-12(13)2)14(11-19)15(17)16(3,4)5/h7-10,14-15,19H,6,11,17H2,1-5H3 |
| InChIKey | YVYXJDASBGBVRK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |