About 3-amino-4,4-dimethyl-2-(3-morpholin-4-ylpyrrolidin-1-yl)pentan-1-ol
3-amino-4,4-dimethyl-2-(3-morpholin-4-ylpyrrolidin-1-yl)pentan-1-ol (PubChem CID 114357241) has the molecular formula C15H31N3O2
and a molecular weight of 285.43 g/mol. Its IUPAC name is 3-amino-4,4-dimethyl-2-(3-morpholin-4-ylpyrrolidin-1-yl)pentan-1-ol.
Molecular Properties
| Compound Name | 3-amino-4,4-dimethyl-2-(3-morpholin-4-ylpyrrolidin-1-yl)pentan-1-ol |
| PubChem CID | 114357241 |
| Molecular Formula | C15H31N3O2 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.24 |
| IUPAC Name | 3-amino-4,4-dimethyl-2-(3-morpholin-4-ylpyrrolidin-1-yl)pentan-1-ol |
| SMILES | CC(C)(C)C(N)C(CO)N1CCC(N2CCOCC2)C1 |
| InChI | InChI=1S/C15H31N3O2/c1-15(2,3)14(16)13(11-19)18-5-4-12(10-18)17-6-8-20-9-7-17/h12-14,19H,4-11,16H2,1-3H3 |
| InChIKey | LFFAXRJZORLZBM-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-4,4-dimethyl-2-(3-morpholin-4-ylpyrrolidin-1-yl)pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4,4-dimethyl-2-(3-morpholin-4-ylpyrrolidin-1-yl)pentan-1-ol?
The IUPAC name of 3-amino-4,4-dimethyl-2-(3-morpholin-4-ylpyrrolidin-1-yl)pentan-1-ol (CID 114357241) is 3-amino-4,4-dimethyl-2-(3-morpholin-4-ylpyrrolidin-1-yl)pentan-1-ol.
What is the SMILES notation for 3-amino-4,4-dimethyl-2-(3-morpholin-4-ylpyrrolidin-1-yl)pentan-1-ol?
The canonical SMILES for 3-amino-4,4-dimethyl-2-(3-morpholin-4-ylpyrrolidin-1-yl)pentan-1-ol is CC(C)(C)C(N)C(CO)N1CCC(N2CCOCC2)C1.
What is the InChIKey of 3-amino-4,4-dimethyl-2-(3-morpholin-4-ylpyrrolidin-1-yl)pentan-1-ol?
The InChIKey is LFFAXRJZORLZBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31N3O2/c1-15(2,3)14(16)13(11-19)18-5-4-12(10-18)17-6-8-20-9-7-17/h12-14,19H,4-11,16H2,1-3H3.
What are the key properties of 3-amino-4,4-dimethyl-2-(3-morpholin-4-ylpyrrolidin-1-yl)pentan-1-ol?
3-amino-4,4-dimethyl-2-(3-morpholin-4-ylpyrrolidin-1-yl)pentan-1-ol has a molecular weight of 285.43 g/mol, XLogP of 0.13, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4,4-dimethyl-2-(3-morpholin-4-ylpyrrolidin-1-yl)pentan-1-ol is sourced from PubChem (CID 114357241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).