C16H33N3O2 — CID 64790693
2-(ethylamino)-2-methyl-4-(3-morpholin-4-ylpyrrolidin-1-yl)pentan-1-ol (PubChem CID 64790693) has the molecular formula C16H33N3O2 and a molecular weight of 299.46 g/mol. Its IUPAC name is 2-(ethylamino)-2-methyl-4-(3-morpholin-4-ylpyrrolidin-1-yl)pentan-1-ol.
| Compound Name | 2-(ethylamino)-2-methyl-4-(3-morpholin-4-ylpyrrolidin-1-yl)pentan-1-ol |
|---|---|
| PubChem CID | 64790693 |
| Molecular Formula | C16H33N3O2 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.26 |
| IUPAC Name | 2-(ethylamino)-2-methyl-4-(3-morpholin-4-ylpyrrolidin-1-yl)pentan-1-ol |
| SMILES | CCNC(C)(CO)CC(C)N1CCC(N2CCOCC2)C1 |
| InChI | InChI=1S/C16H33N3O2/c1-4-17-16(3,13-20)11-14(2)19-6-5-15(12-19)18-7-9-21-10-8-18/h14-15,17,20H,4-13H2,1-3H3 |
| InChIKey | QVCVLRORJZKIML-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 47.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |