C9H22N2O4S — CID 114357469
3-amino-4-methoxy-2-[methyl(2-methylsulfonylethyl)amino]butan-1-ol (PubChem CID 114357469) has the molecular formula C9H22N2O4S and a molecular weight of 254.35 g/mol. Its IUPAC name is 3-amino-4-methoxy-2-[methyl(2-methylsulfonylethyl)amino]butan-1-ol.
| Compound Name | 3-amino-4-methoxy-2-[methyl(2-methylsulfonylethyl)amino]butan-1-ol |
|---|---|
| PubChem CID | 114357469 |
| Molecular Formula | C9H22N2O4S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 3-amino-4-methoxy-2-[methyl(2-methylsulfonylethyl)amino]butan-1-ol |
| SMILES | COCC(N)C(CO)N(C)CCS(C)(=O)=O |
| InChI | InChI=1S/C9H22N2O4S/c1-11(4-5-16(3,13)14)9(6-12)8(10)7-15-2/h8-9,12H,4-7,10H2,1-3H3 |
| InChIKey | WTAWXOCFTPWBLA-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |