About 2-(1-aminopropyl)-4-cyclopropyl-1,3-thiazole-5-carboxylic acid
2-(1-aminopropyl)-4-cyclopropyl-1,3-thiazole-5-carboxylic acid (PubChem CID 114358418) has the molecular formula C10H14N2O2S
and a molecular weight of 226.30 g/mol. Its IUPAC name is 2-(1-aminopropyl)-4-cyclopropyl-1,3-thiazole-5-carboxylic acid.
Analyze 2-(1-aminopropyl)-4-cyclopropyl-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-aminopropyl)-4-cyclopropyl-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-(1-aminopropyl)-4-cyclopropyl-1,3-thiazole-5-carboxylic acid (CID 114358418) is 2-(1-aminopropyl)-4-cyclopropyl-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-(1-aminopropyl)-4-cyclopropyl-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-(1-aminopropyl)-4-cyclopropyl-1,3-thiazole-5-carboxylic acid is CCC(N)c1nc(C2CC2)c(C(=O)O)s1.
What is the InChIKey of 2-(1-aminopropyl)-4-cyclopropyl-1,3-thiazole-5-carboxylic acid?
The InChIKey is DKFUBMFAETZDRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2S/c1-2-6(11)9-12-7(5-3-4-5)8(15-9)10(13)14/h5-6H,2-4,11H2,1H3,(H,13,14).
What are the key properties of 2-(1-aminopropyl)-4-cyclopropyl-1,3-thiazole-5-carboxylic acid?
2-(1-aminopropyl)-4-cyclopropyl-1,3-thiazole-5-carboxylic acid has a molecular weight of 226.30 g/mol, XLogP of 2.13, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-aminopropyl)-4-cyclopropyl-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 114358418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).