2-(1-aminobutyl)-4-propan-2-yl-1,3-thiazole-5-carboxylic acid

C11H18N2O2S — CID 114358432

IUPAC2-(1-aminobutyl)-4-propan-2-yl-1,3-thiazole-5-carboxylic acid
SMILESCCCC(N)c1nc(C(C)C)c(C(=O)O)s1
InChIInChI=1S/C11H18N2O2S/c1-4-5-7(12)10-13-8(6(2)3)9(16-10)11(14)15/h6-7H,4-5,12H2,1-3H3,(H,14,15)
InChIKeyNRXWPZQIVVTVCO-UHFFFAOYSA-N
MW242.34 g/mol
LogP2.76
Rot. Bonds5

About 2-(1-aminobutyl)-4-propan-2-yl-1,3-thiazole-5-carboxylic acid

2-(1-aminobutyl)-4-propan-2-yl-1,3-thiazole-5-carboxylic acid (PubChem CID 114358432) has the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. Its IUPAC name is 2-(1-aminobutyl)-4-propan-2-yl-1,3-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name2-(1-aminobutyl)-4-propan-2-yl-1,3-thiazole-5-carboxylic acid
PubChem CID114358432
Molecular FormulaC11H18N2O2S
Molecular Weight242.34 g/mol
Exact Mass242.11
IUPAC Name2-(1-aminobutyl)-4-propan-2-yl-1,3-thiazole-5-carboxylic acid
SMILESCCCC(N)c1nc(C(C)C)c(C(=O)O)s1
InChIInChI=1S/C11H18N2O2S/c1-4-5-7(12)10-13-8(6(2)3)9(16-10)11(14)15/h6-7H,4-5,12H2,1-3H3,(H,14,15)
InChIKeyNRXWPZQIVVTVCO-UHFFFAOYSA-N
XLogP2.76
TPSA76.21 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.34
LogP ≤ 52.76
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-(1-aminobutyl)-4-propan-2-yl-1,3-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1-aminobutyl)-4-propan-2-yl-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-(1-aminobutyl)-4-propan-2-yl-1,3-thiazole-5-carboxylic acid (CID 114358432) is 2-(1-aminobutyl)-4-propan-2-yl-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-(1-aminobutyl)-4-propan-2-yl-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-(1-aminobutyl)-4-propan-2-yl-1,3-thiazole-5-carboxylic acid is CCCC(N)c1nc(C(C)C)c(C(=O)O)s1.
What is the InChIKey of 2-(1-aminobutyl)-4-propan-2-yl-1,3-thiazole-5-carboxylic acid?
The InChIKey is NRXWPZQIVVTVCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O2S/c1-4-5-7(12)10-13-8(6(2)3)9(16-10)11(14)15/h6-7H,4-5,12H2,1-3H3,(H,14,15).
What are the key properties of 2-(1-aminobutyl)-4-propan-2-yl-1,3-thiazole-5-carboxylic acid?
2-(1-aminobutyl)-4-propan-2-yl-1,3-thiazole-5-carboxylic acid has a molecular weight of 242.34 g/mol, XLogP of 2.76, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-aminobutyl)-4-propan-2-yl-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 114358432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).