5,7-dibromo-3-propyl-1-benzofuran-2-carboxylic acid

C12H10Br2O3 — CID 114359150

IUPAC5,7-dibromo-3-propyl-1-benzofuran-2-carboxylic acid
SMILESCCCc1c(C(=O)O)oc2c(Br)cc(Br)cc12
InChIInChI=1S/C12H10Br2O3/c1-2-3-7-8-4-6(13)5-9(14)10(8)17-11(7)12(15)16/h4-5H,2-3H2,1H3,(H,15,16)
InChIKeyGPHFYUZXJORVGW-UHFFFAOYSA-N
MW362.02 g/mol
LogP4.61
Rot. Bonds3

About 5,7-dibromo-3-propyl-1-benzofuran-2-carboxylic acid

5,7-dibromo-3-propyl-1-benzofuran-2-carboxylic acid (PubChem CID 114359150) has the molecular formula C12H10Br2O3 and a molecular weight of 362.02 g/mol. Its IUPAC name is 5,7-dibromo-3-propyl-1-benzofuran-2-carboxylic acid.

Molecular Properties

Compound Name5,7-dibromo-3-propyl-1-benzofuran-2-carboxylic acid
PubChem CID114359150
Molecular FormulaC12H10Br2O3
Molecular Weight362.02 g/mol
Exact Mass359.90
IUPAC Name5,7-dibromo-3-propyl-1-benzofuran-2-carboxylic acid
SMILESCCCc1c(C(=O)O)oc2c(Br)cc(Br)cc12
InChIInChI=1S/C12H10Br2O3/c1-2-3-7-8-4-6(13)5-9(14)10(8)17-11(7)12(15)16/h4-5H,2-3H2,1H3,(H,15,16)
InChIKeyGPHFYUZXJORVGW-UHFFFAOYSA-N
XLogP4.61
TPSA50.44 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500362.02
LogP ≤ 54.61
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 5,7-dibromo-3-propyl-1-benzofuran-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5,7-dibromo-3-propyl-1-benzofuran-2-carboxylic acid?
The IUPAC name of 5,7-dibromo-3-propyl-1-benzofuran-2-carboxylic acid (CID 114359150) is 5,7-dibromo-3-propyl-1-benzofuran-2-carboxylic acid.
What is the SMILES notation for 5,7-dibromo-3-propyl-1-benzofuran-2-carboxylic acid?
The canonical SMILES for 5,7-dibromo-3-propyl-1-benzofuran-2-carboxylic acid is CCCc1c(C(=O)O)oc2c(Br)cc(Br)cc12.
What is the InChIKey of 5,7-dibromo-3-propyl-1-benzofuran-2-carboxylic acid?
The InChIKey is GPHFYUZXJORVGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10Br2O3/c1-2-3-7-8-4-6(13)5-9(14)10(8)17-11(7)12(15)16/h4-5H,2-3H2,1H3,(H,15,16).
What are the key properties of 5,7-dibromo-3-propyl-1-benzofuran-2-carboxylic acid?
5,7-dibromo-3-propyl-1-benzofuran-2-carboxylic acid has a molecular weight of 362.02 g/mol, XLogP of 4.61, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dibromo-3-propyl-1-benzofuran-2-carboxylic acid is sourced from PubChem (CID 114359150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).