C12H10Br2O3 — CID 114359150
5,7-dibromo-3-propyl-1-benzofuran-2-carboxylic acid (PubChem CID 114359150) has the molecular formula C12H10Br2O3 and a molecular weight of 362.02 g/mol. Its IUPAC name is 5,7-dibromo-3-propyl-1-benzofuran-2-carboxylic acid.
| Compound Name | 5,7-dibromo-3-propyl-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 114359150 |
| Molecular Formula | C12H10Br2O3 |
| Molecular Weight | 362.02 g/mol |
| Exact Mass | 359.90 |
| IUPAC Name | 5,7-dibromo-3-propyl-1-benzofuran-2-carboxylic acid |
| SMILES | CCCc1c(C(=O)O)oc2c(Br)cc(Br)cc12 |
| InChI | InChI=1S/C12H10Br2O3/c1-2-3-7-8-4-6(13)5-9(14)10(8)17-11(7)12(15)16/h4-5H,2-3H2,1H3,(H,15,16) |
| InChIKey | GPHFYUZXJORVGW-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.02 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |