4,7-difluoro-3-propan-2-yl-1-benzothiophene-2-carboxylic acid

C12H10F2O2S — CID 114359288

IUPAC4,7-difluoro-3-propan-2-yl-1-benzothiophene-2-carboxylic acid
SMILESCC(C)c1c(C(=O)O)sc2c(F)ccc(F)c12
InChIInChI=1S/C12H10F2O2S/c1-5(2)8-9-6(13)3-4-7(14)10(9)17-11(8)12(15)16/h3-5H,1-2H3,(H,15,16)
InChIKeyKRWMPXQHPQRMMU-UHFFFAOYSA-N
MW256.27 g/mol
LogP4.00
Rot. Bonds2

About 4,7-difluoro-3-propan-2-yl-1-benzothiophene-2-carboxylic acid

4,7-difluoro-3-propan-2-yl-1-benzothiophene-2-carboxylic acid (PubChem CID 114359288) has the molecular formula C12H10F2O2S and a molecular weight of 256.27 g/mol. Its IUPAC name is 4,7-difluoro-3-propan-2-yl-1-benzothiophene-2-carboxylic acid.

Molecular Properties

Compound Name4,7-difluoro-3-propan-2-yl-1-benzothiophene-2-carboxylic acid
PubChem CID114359288
Molecular FormulaC12H10F2O2S
Molecular Weight256.27 g/mol
Exact Mass256.04
IUPAC Name4,7-difluoro-3-propan-2-yl-1-benzothiophene-2-carboxylic acid
SMILESCC(C)c1c(C(=O)O)sc2c(F)ccc(F)c12
InChIInChI=1S/C12H10F2O2S/c1-5(2)8-9-6(13)3-4-7(14)10(9)17-11(8)12(15)16/h3-5H,1-2H3,(H,15,16)
InChIKeyKRWMPXQHPQRMMU-UHFFFAOYSA-N
XLogP4.00
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.27
LogP ≤ 54.00
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4,7-difluoro-3-propan-2-yl-1-benzothiophene-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,7-difluoro-3-propan-2-yl-1-benzothiophene-2-carboxylic acid?
The IUPAC name of 4,7-difluoro-3-propan-2-yl-1-benzothiophene-2-carboxylic acid (CID 114359288) is 4,7-difluoro-3-propan-2-yl-1-benzothiophene-2-carboxylic acid.
What is the SMILES notation for 4,7-difluoro-3-propan-2-yl-1-benzothiophene-2-carboxylic acid?
The canonical SMILES for 4,7-difluoro-3-propan-2-yl-1-benzothiophene-2-carboxylic acid is CC(C)c1c(C(=O)O)sc2c(F)ccc(F)c12.
What is the InChIKey of 4,7-difluoro-3-propan-2-yl-1-benzothiophene-2-carboxylic acid?
The InChIKey is KRWMPXQHPQRMMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F2O2S/c1-5(2)8-9-6(13)3-4-7(14)10(9)17-11(8)12(15)16/h3-5H,1-2H3,(H,15,16).
What are the key properties of 4,7-difluoro-3-propan-2-yl-1-benzothiophene-2-carboxylic acid?
4,7-difluoro-3-propan-2-yl-1-benzothiophene-2-carboxylic acid has a molecular weight of 256.27 g/mol, XLogP of 4.00, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-difluoro-3-propan-2-yl-1-benzothiophene-2-carboxylic acid is sourced from PubChem (CID 114359288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).