C12H10F2O2S — CID 114359288
4,7-difluoro-3-propan-2-yl-1-benzothiophene-2-carboxylic acid (PubChem CID 114359288) has the molecular formula C12H10F2O2S and a molecular weight of 256.27 g/mol. Its IUPAC name is 4,7-difluoro-3-propan-2-yl-1-benzothiophene-2-carboxylic acid.
| Compound Name | 4,7-difluoro-3-propan-2-yl-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 114359288 |
| Molecular Formula | C12H10F2O2S |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 4,7-difluoro-3-propan-2-yl-1-benzothiophene-2-carboxylic acid |
| SMILES | CC(C)c1c(C(=O)O)sc2c(F)ccc(F)c12 |
| InChI | InChI=1S/C12H10F2O2S/c1-5(2)8-9-6(13)3-4-7(14)10(9)17-11(8)12(15)16/h3-5H,1-2H3,(H,15,16) |
| InChIKey | KRWMPXQHPQRMMU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |