C11H10F2O2S — CID 143669652
4,7-difluoro-3-hydroxy-1-benzothiophene-2-carbaldehyde;ethane (PubChem CID 143669652) has the molecular formula C11H10F2O2S and a molecular weight of 244.26 g/mol. Its IUPAC name is 4,7-difluoro-3-hydroxy-1-benzothiophene-2-carbaldehyde;ethane.
| Compound Name | 4,7-difluoro-3-hydroxy-1-benzothiophene-2-carbaldehyde;ethane |
|---|---|
| PubChem CID | 143669652 |
| Molecular Formula | C11H10F2O2S |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 4,7-difluoro-3-hydroxy-1-benzothiophene-2-carbaldehyde;ethane |
| SMILES | CC.O=Cc1sc2c(F)ccc(F)c2c1O |
| InChI | InChI=1S/C9H4F2O2S.C2H6/c10-4-1-2-5(11)9-7(4)8(13)6(3-12)14-9;1-2/h1-3,13H;1-2H3 |
| InChIKey | FXNGVYPGFAFRGE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|