C17H23FN2S — CID 114365280
N-[[2-(4-fluoro-2-methylphenyl)-4-propan-2-yl-1,3-thiazol-5-yl]methyl]propan-1-amine (PubChem CID 114365280) has the molecular formula C17H23FN2S and a molecular weight of 306.45 g/mol. Its IUPAC name is N-[[2-(4-fluoro-2-methylphenyl)-4-propan-2-yl-1,3-thiazol-5-yl]methyl]propan-1-amine.
| Compound Name | N-[[2-(4-fluoro-2-methylphenyl)-4-propan-2-yl-1,3-thiazol-5-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 114365280 |
| Molecular Formula | C17H23FN2S |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | N-[[2-(4-fluoro-2-methylphenyl)-4-propan-2-yl-1,3-thiazol-5-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1sc(-c2ccc(F)cc2C)nc1C(C)C |
| InChI | InChI=1S/C17H23FN2S/c1-5-8-19-10-15-16(11(2)3)20-17(21-15)14-7-6-13(18)9-12(14)4/h6-7,9,11,19H,5,8,10H2,1-4H3 |
| InChIKey | WCTJDQWDLYPJFU-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|