C10H19N3S — CID 114365185
4-propan-2-yl-5-(propylaminomethyl)-1,3-thiazol-2-amine (PubChem CID 114365185) has the molecular formula C10H19N3S and a molecular weight of 213.35 g/mol. Its IUPAC name is 4-propan-2-yl-5-(propylaminomethyl)-1,3-thiazol-2-amine.
| Compound Name | 4-propan-2-yl-5-(propylaminomethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 114365185 |
| Molecular Formula | C10H19N3S |
| Molecular Weight | 213.35 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 4-propan-2-yl-5-(propylaminomethyl)-1,3-thiazol-2-amine |
| SMILES | CCCNCc1sc(N)nc1C(C)C |
| InChI | InChI=1S/C10H19N3S/c1-4-5-12-6-8-9(7(2)3)13-10(11)14-8/h7,12H,4-6H2,1-3H3,(H2,11,13) |
| InChIKey | JNDIAXPVTPFBQU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|