C15H28N2S2 — CID 114365285
N-[[2-(tert-butylsulfanylmethyl)-4-propan-2-yl-1,3-thiazol-5-yl]methyl]propan-1-amine (PubChem CID 114365285) has the molecular formula C15H28N2S2 and a molecular weight of 300.54 g/mol. Its IUPAC name is N-[[2-(tert-butylsulfanylmethyl)-4-propan-2-yl-1,3-thiazol-5-yl]methyl]propan-1-amine.
| Compound Name | N-[[2-(tert-butylsulfanylmethyl)-4-propan-2-yl-1,3-thiazol-5-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 114365285 |
| Molecular Formula | C15H28N2S2 |
| Molecular Weight | 300.54 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | N-[[2-(tert-butylsulfanylmethyl)-4-propan-2-yl-1,3-thiazol-5-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1sc(CSC(C)(C)C)nc1C(C)C |
| InChI | InChI=1S/C15H28N2S2/c1-7-8-16-9-12-14(11(2)3)17-13(19-12)10-18-15(4,5)6/h11,16H,7-10H2,1-6H3 |
| InChIKey | SBAYQDBPGVUHCN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.54 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|