C16H31N3S — CID 79392809
N-methyl-N-(2-methylbutan-2-yl)-4-propan-2-yl-5-(propylaminomethyl)-1,3-thiazol-2-amine (PubChem CID 79392809) has the molecular formula C16H31N3S and a molecular weight of 297.51 g/mol. Its IUPAC name is N-methyl-N-(2-methylbutan-2-yl)-4-propan-2-yl-5-(propylaminomethyl)-1,3-thiazol-2-amine.
| Compound Name | N-methyl-N-(2-methylbutan-2-yl)-4-propan-2-yl-5-(propylaminomethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 79392809 |
| Molecular Formula | C16H31N3S |
| Molecular Weight | 297.51 g/mol |
| Exact Mass | 297.22 |
| IUPAC Name | N-methyl-N-(2-methylbutan-2-yl)-4-propan-2-yl-5-(propylaminomethyl)-1,3-thiazol-2-amine |
| SMILES | CCCNCc1sc(N(C)C(C)(C)CC)nc1C(C)C |
| InChI | InChI=1S/C16H31N3S/c1-8-10-17-11-13-14(12(3)4)18-15(20-13)19(7)16(5,6)9-2/h12,17H,8-11H2,1-7H3 |
| InChIKey | ZUGJTRNYVQDMLL-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.51 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|