C13H21NO3 — CID 114370828
methyl 2-butyl-4-tert-butyl-1,3-oxazole-5-carboxylate (PubChem CID 114370828) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is methyl 2-butyl-4-tert-butyl-1,3-oxazole-5-carboxylate.
| Compound Name | methyl 2-butyl-4-tert-butyl-1,3-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 114370828 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | methyl 2-butyl-4-tert-butyl-1,3-oxazole-5-carboxylate |
| SMILES | CCCCc1nc(C(C)(C)C)c(C(=O)OC)o1 |
| InChI | InChI=1S/C13H21NO3/c1-6-7-8-9-14-11(13(2,3)4)10(17-9)12(15)16-5/h6-8H2,1-5H3 |
| InChIKey | IGFMRAUXJCBKES-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |