C18H23NO3 — CID 15646209
methyl 2-heptyl-5-phenyl-1,3-oxazole-4-carboxylate (PubChem CID 15646209) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is methyl 2-heptyl-5-phenyl-1,3-oxazole-4-carboxylate.
| Compound Name | methyl 2-heptyl-5-phenyl-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 15646209 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | methyl 2-heptyl-5-phenyl-1,3-oxazole-4-carboxylate |
| SMILES | CCCCCCCc1nc(C(=O)OC)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C18H23NO3/c1-3-4-5-6-10-13-15-19-16(18(20)21-2)17(22-15)14-11-8-7-9-12-14/h7-9,11-12H,3-6,10,13H2,1-2H3 |
| InChIKey | JQWKIFLEXLTSLH-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|