C17H17N3O3 — CID 174690828
1H-pyrazol-5-yl 2-butyl-5-phenyl-1,3-oxazole-4-carboxylate (PubChem CID 174690828) has the molecular formula C17H17N3O3 and a molecular weight of 311.34 g/mol. Its IUPAC name is 1H-pyrazol-5-yl 2-butyl-5-phenyl-1,3-oxazole-4-carboxylate.
| Compound Name | 1H-pyrazol-5-yl 2-butyl-5-phenyl-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 174690828 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 1H-pyrazol-5-yl 2-butyl-5-phenyl-1,3-oxazole-4-carboxylate |
| SMILES | CCCCc1nc(C(=O)Oc2ccn[nH]2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C17H17N3O3/c1-2-3-9-13-19-15(17(21)23-14-10-11-18-20-14)16(22-13)12-7-5-4-6-8-12/h4-8,10-11H,2-3,9H2,1H3,(H,18,20) |
| InChIKey | VWVKEOPFQJNZJH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |