About 1H-pyrazol-5-yl N-methylcarbamate
1H-pyrazol-5-yl N-methylcarbamate (PubChem CID 154289167) has the molecular formula C5H7N3O2
and a molecular weight of 141.13 g/mol. Its IUPAC name is 1H-pyrazol-5-yl N-methylcarbamate.
Molecular Properties
| Compound Name | 1H-pyrazol-5-yl N-methylcarbamate |
| PubChem CID | 154289167 |
| Molecular Formula | C5H7N3O2 |
| Molecular Weight | 141.13 g/mol |
| Exact Mass | 141.05 |
| IUPAC Name | 1H-pyrazol-5-yl N-methylcarbamate |
| SMILES | CNC(=O)Oc1ccn[nH]1 |
| InChI | InChI=1S/C5H7N3O2/c1-6-5(9)10-4-2-3-7-8-4/h2-3H,1H3,(H,6,9)(H,7,8) |
| InChIKey | PRNCXSCGSSMXEH-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.13 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-pyrazol-5-yl N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrazol-5-yl N-methylcarbamate?
The IUPAC name of 1H-pyrazol-5-yl N-methylcarbamate (CID 154289167) is 1H-pyrazol-5-yl N-methylcarbamate.
What is the SMILES notation for 1H-pyrazol-5-yl N-methylcarbamate?
The canonical SMILES for 1H-pyrazol-5-yl N-methylcarbamate is CNC(=O)Oc1ccn[nH]1.
What is the InChIKey of 1H-pyrazol-5-yl N-methylcarbamate?
The InChIKey is PRNCXSCGSSMXEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3O2/c1-6-5(9)10-4-2-3-7-8-4/h2-3H,1H3,(H,6,9)(H,7,8).
What are the key properties of 1H-pyrazol-5-yl N-methylcarbamate?
1H-pyrazol-5-yl N-methylcarbamate has a molecular weight of 141.13 g/mol, XLogP of 0.13, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrazol-5-yl N-methylcarbamate is sourced from PubChem (CID 154289167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).