C11H11BrN4O3S — CID 68807448
1H-pyrazol-5-yl N-[(4-bromo-5-methylthiophene-2-carbonyl)amino]-N-methylcarbamate (PubChem CID 68807448) has the molecular formula C11H11BrN4O3S and a molecular weight of 359.21 g/mol. Its IUPAC name is 1H-pyrazol-5-yl N-[(4-bromo-5-methylthiophene-2-carbonyl)amino]-N-methylcarbamate.
| Compound Name | 1H-pyrazol-5-yl N-[(4-bromo-5-methylthiophene-2-carbonyl)amino]-N-methylcarbamate |
|---|---|
| PubChem CID | 68807448 |
| Molecular Formula | C11H11BrN4O3S |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 357.97 |
| IUPAC Name | 1H-pyrazol-5-yl N-[(4-bromo-5-methylthiophene-2-carbonyl)amino]-N-methylcarbamate |
| SMILES | Cc1sc(C(=O)NN(C)C(=O)Oc2ccn[nH]2)cc1Br |
| InChI | InChI=1S/C11H11BrN4O3S/c1-6-7(12)5-8(20-6)10(17)15-16(2)11(18)19-9-3-4-13-14-9/h3-5H,1-2H3,(H,13,14)(H,15,17) |
| InChIKey | WCNDKUKNFJDGFZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|