C12H12INO3S — CID 114371049
methyl 2-(5-iodothiophen-3-yl)-4-propyl-1,3-oxazole-5-carboxylate (PubChem CID 114371049) has the molecular formula C12H12INO3S and a molecular weight of 377.20 g/mol. Its IUPAC name is methyl 2-(5-iodothiophen-3-yl)-4-propyl-1,3-oxazole-5-carboxylate.
| Compound Name | methyl 2-(5-iodothiophen-3-yl)-4-propyl-1,3-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 114371049 |
| Molecular Formula | C12H12INO3S |
| Molecular Weight | 377.20 g/mol |
| Exact Mass | 376.96 |
| IUPAC Name | methyl 2-(5-iodothiophen-3-yl)-4-propyl-1,3-oxazole-5-carboxylate |
| SMILES | CCCc1nc(-c2csc(I)c2)oc1C(=O)OC |
| InChI | InChI=1S/C12H12INO3S/c1-3-4-8-10(12(15)16-2)17-11(14-8)7-5-9(13)18-6-7/h5-6H,3-4H2,1-2H3 |
| InChIKey | MRYWHOPXMMBKSP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.20 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|