C16H19NO4 — CID 114371286
methyl 2-(4-ethoxyphenyl)-4-propyl-1,3-oxazole-5-carboxylate (PubChem CID 114371286) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is methyl 2-(4-ethoxyphenyl)-4-propyl-1,3-oxazole-5-carboxylate.
| Compound Name | methyl 2-(4-ethoxyphenyl)-4-propyl-1,3-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 114371286 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | methyl 2-(4-ethoxyphenyl)-4-propyl-1,3-oxazole-5-carboxylate |
| SMILES | CCCc1nc(-c2ccc(OCC)cc2)oc1C(=O)OC |
| InChI | InChI=1S/C16H19NO4/c1-4-6-13-14(16(18)19-3)21-15(17-13)11-7-9-12(10-8-11)20-5-2/h7-10H,4-6H2,1-3H3 |
| InChIKey | MYNFUWVQONKZGG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |