C17H20BrNO4 — CID 143299975
ethyl 4-(bromomethyl)-2-(4-butoxyphenyl)-1,3-oxazole-5-carboxylate (PubChem CID 143299975) has the molecular formula C17H20BrNO4 and a molecular weight of 382.25 g/mol. Its IUPAC name is ethyl 4-(bromomethyl)-2-(4-butoxyphenyl)-1,3-oxazole-5-carboxylate.
| Compound Name | ethyl 4-(bromomethyl)-2-(4-butoxyphenyl)-1,3-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 143299975 |
| Molecular Formula | C17H20BrNO4 |
| Molecular Weight | 382.25 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | ethyl 4-(bromomethyl)-2-(4-butoxyphenyl)-1,3-oxazole-5-carboxylate |
| SMILES | CCCCOc1ccc(-c2nc(CBr)c(C(=O)OCC)o2)cc1 |
| InChI | InChI=1S/C17H20BrNO4/c1-3-5-10-22-13-8-6-12(7-9-13)16-19-14(11-18)15(23-16)17(20)21-4-2/h6-9H,3-5,10-11H2,1-2H3 |
| InChIKey | TUZBVKIXWXPTNX-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.25 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|