C16H19NO4 — CID 4116298
2-(4-butoxyphenyl)-4-methoxy-5-methyl-1,3-oxazin-6-one (PubChem CID 4116298) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is 2-(4-butoxyphenyl)-4-methoxy-5-methyl-1,3-oxazin-6-one.
| Compound Name | 2-(4-butoxyphenyl)-4-methoxy-5-methyl-1,3-oxazin-6-one |
|---|---|
| PubChem CID | 4116298 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 2-(4-butoxyphenyl)-4-methoxy-5-methyl-1,3-oxazin-6-one |
| SMILES | CCCCOc1ccc(-c2nc(OC)c(C)c(=O)o2)cc1 |
| InChI | InChI=1S/C16H19NO4/c1-4-5-10-20-13-8-6-12(7-9-13)15-17-14(19-3)11(2)16(18)21-15/h6-9H,4-5,10H2,1-3H3 |
| InChIKey | XWWMTQJISUJSCR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|