C31H28N2O3 — CID 118531033
2-(4-hexoxyphenyl)-7-(4-methylphenyl)-[1,3]benzoxazolo[7,6-g][1,3]benzoxazole (PubChem CID 118531033) has the molecular formula C31H28N2O3 and a molecular weight of 476.58 g/mol. Its IUPAC name is 2-(4-hexoxyphenyl)-7-(4-methylphenyl)-[1,3]benzoxazolo[7,6-g][1,3]benzoxazole.
| Compound Name | 2-(4-hexoxyphenyl)-7-(4-methylphenyl)-[1,3]benzoxazolo[7,6-g][1,3]benzoxazole |
|---|---|
| PubChem CID | 118531033 |
| Molecular Formula | C31H28N2O3 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 2-(4-hexoxyphenyl)-7-(4-methylphenyl)-[1,3]benzoxazolo[7,6-g][1,3]benzoxazole |
| SMILES | CCCCCCOc1ccc(-c2nc3ccc4c(ccc5nc(-c6ccc(C)cc6)oc54)c3o2)cc1 |
| InChI | InChI=1S/C31H28N2O3/c1-3-4-5-6-19-34-23-13-11-22(12-14-23)31-33-27-18-16-24-25(29(27)36-31)15-17-26-28(24)35-30(32-26)21-9-7-20(2)8-10-21/h7-18H,3-6,19H2,1-2H3 |
| InChIKey | QVFCVPYMLNMOHX-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 61.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|