C32H30N2O3 — CID 118531043
2-(4-heptoxyphenyl)-7-(4-methylphenyl)-[1,3]benzoxazolo[5,4-e][1,3]benzoxazole (PubChem CID 118531043) has the molecular formula C32H30N2O3 and a molecular weight of 490.60 g/mol. Its IUPAC name is 2-(4-heptoxyphenyl)-7-(4-methylphenyl)-[1,3]benzoxazolo[5,4-e][1,3]benzoxazole.
| Compound Name | 2-(4-heptoxyphenyl)-7-(4-methylphenyl)-[1,3]benzoxazolo[5,4-e][1,3]benzoxazole |
|---|---|
| PubChem CID | 118531043 |
| Molecular Formula | C32H30N2O3 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | 2-(4-heptoxyphenyl)-7-(4-methylphenyl)-[1,3]benzoxazolo[5,4-e][1,3]benzoxazole |
| SMILES | CCCCCCCOc1ccc(-c2nc3c(ccc4c3ccc3oc(-c5ccc(C)cc5)nc34)o2)cc1 |
| InChI | InChI=1S/C32H30N2O3/c1-3-4-5-6-7-20-35-24-14-12-23(13-15-24)32-34-30-26-16-18-27-29(25(26)17-19-28(30)37-32)33-31(36-27)22-10-8-21(2)9-11-22/h8-19H,3-7,20H2,1-2H3 |
| InChIKey | QQEOQQMUBXQESR-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 61.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|