C15H19NO3 — CID 143299914
[2-(4-butoxyphenyl)-4-methyl-1,3-oxazol-5-yl]methanol (PubChem CID 143299914) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is [2-(4-butoxyphenyl)-4-methyl-1,3-oxazol-5-yl]methanol.
| Compound Name | [2-(4-butoxyphenyl)-4-methyl-1,3-oxazol-5-yl]methanol |
|---|---|
| PubChem CID | 143299914 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | [2-(4-butoxyphenyl)-4-methyl-1,3-oxazol-5-yl]methanol |
| SMILES | CCCCOc1ccc(-c2nc(C)c(CO)o2)cc1 |
| InChI | InChI=1S/C15H19NO3/c1-3-4-9-18-13-7-5-12(6-8-13)15-16-11(2)14(10-17)19-15/h5-8,17H,3-4,9-10H2,1-2H3 |
| InChIKey | XHRMGXZIDKPBBH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|