5-(4-butoxyphenyl)-1,2,4-oxadiazole-3-carboxylic acid

C13H14N2O4 — CID 63448625

IUPAC5-(4-butoxyphenyl)-1,2,4-oxadiazole-3-carboxylic acid
SMILESCCCCOc1ccc(-c2nc(C(=O)O)no2)cc1
InChIInChI=1S/C13H14N2O4/c1-2-3-8-18-10-6-4-9(5-7-10)12-14-11(13(16)17)15-19-12/h4-7H,2-3,8H2,1H3,(H,16,17)
InChIKeyBCOVQYHTKKCZQA-UHFFFAOYSA-N
MW262.27 g/mol
LogP2.61
Rot. Bonds6

About 5-(4-butoxyphenyl)-1,2,4-oxadiazole-3-carboxylic acid

5-(4-butoxyphenyl)-1,2,4-oxadiazole-3-carboxylic acid (PubChem CID 63448625) has the molecular formula C13H14N2O4 and a molecular weight of 262.27 g/mol. Its IUPAC name is 5-(4-butoxyphenyl)-1,2,4-oxadiazole-3-carboxylic acid.

Molecular Properties

Compound Name5-(4-butoxyphenyl)-1,2,4-oxadiazole-3-carboxylic acid
PubChem CID63448625
Molecular FormulaC13H14N2O4
Molecular Weight262.27 g/mol
Exact Mass262.10
IUPAC Name5-(4-butoxyphenyl)-1,2,4-oxadiazole-3-carboxylic acid
SMILESCCCCOc1ccc(-c2nc(C(=O)O)no2)cc1
InChIInChI=1S/C13H14N2O4/c1-2-3-8-18-10-6-4-9(5-7-10)12-14-11(13(16)17)15-19-12/h4-7H,2-3,8H2,1H3,(H,16,17)
InChIKeyBCOVQYHTKKCZQA-UHFFFAOYSA-N
XLogP2.61
TPSA85.45 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.27
LogP ≤ 52.61
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 5-(4-butoxyphenyl)-1,2,4-oxadiazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(4-butoxyphenyl)-1,2,4-oxadiazole-3-carboxylic acid?
The IUPAC name of 5-(4-butoxyphenyl)-1,2,4-oxadiazole-3-carboxylic acid (CID 63448625) is 5-(4-butoxyphenyl)-1,2,4-oxadiazole-3-carboxylic acid.
What is the SMILES notation for 5-(4-butoxyphenyl)-1,2,4-oxadiazole-3-carboxylic acid?
The canonical SMILES for 5-(4-butoxyphenyl)-1,2,4-oxadiazole-3-carboxylic acid is CCCCOc1ccc(-c2nc(C(=O)O)no2)cc1.
What is the InChIKey of 5-(4-butoxyphenyl)-1,2,4-oxadiazole-3-carboxylic acid?
The InChIKey is BCOVQYHTKKCZQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O4/c1-2-3-8-18-10-6-4-9(5-7-10)12-14-11(13(16)17)15-19-12/h4-7H,2-3,8H2,1H3,(H,16,17).
What are the key properties of 5-(4-butoxyphenyl)-1,2,4-oxadiazole-3-carboxylic acid?
5-(4-butoxyphenyl)-1,2,4-oxadiazole-3-carboxylic acid has a molecular weight of 262.27 g/mol, XLogP of 2.61, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-butoxyphenyl)-1,2,4-oxadiazole-3-carboxylic acid is sourced from PubChem (CID 63448625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).