C21H22N2O4 — CID 5006371
2-(4-butoxyphenyl)-4-[(4-methoxyphenyl)iminomethyl]-1,3-oxazol-5-ol (PubChem CID 5006371) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is 2-(4-butoxyphenyl)-4-[(4-methoxyphenyl)iminomethyl]-1,3-oxazol-5-ol.
| Compound Name | 2-(4-butoxyphenyl)-4-[(4-methoxyphenyl)iminomethyl]-1,3-oxazol-5-ol |
|---|---|
| PubChem CID | 5006371 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 2-(4-butoxyphenyl)-4-[(4-methoxyphenyl)iminomethyl]-1,3-oxazol-5-ol |
| SMILES | CCCCOc1ccc(-c2nc(/C=N/c3ccc(OC)cc3)c(O)o2)cc1 |
| InChI | InChI=1S/C21H22N2O4/c1-3-4-13-26-18-9-5-15(6-10-18)20-23-19(21(24)27-20)14-22-16-7-11-17(25-2)12-8-16/h5-12,14,24H,3-4,13H2,1-2H3/b22-14+ |
| InChIKey | VMUKPQHROYJXPJ-HYARGMPZSA-N |
| XLogP | 4.99 |
| TPSA | 77.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|