C20H19IN2O3 — CID 4987180
2-(4-butoxyphenyl)-4-[(4-iodophenyl)iminomethyl]-1,3-oxazol-5-ol (PubChem CID 4987180) has the molecular formula C20H19IN2O3 and a molecular weight of 462.29 g/mol. Its IUPAC name is 2-(4-butoxyphenyl)-4-[(4-iodophenyl)iminomethyl]-1,3-oxazol-5-ol.
| Compound Name | 2-(4-butoxyphenyl)-4-[(4-iodophenyl)iminomethyl]-1,3-oxazol-5-ol |
|---|---|
| PubChem CID | 4987180 |
| Molecular Formula | C20H19IN2O3 |
| Molecular Weight | 462.29 g/mol |
| Exact Mass | 462.04 |
| IUPAC Name | 2-(4-butoxyphenyl)-4-[(4-iodophenyl)iminomethyl]-1,3-oxazol-5-ol |
| SMILES | CCCCOc1ccc(-c2nc(/C=N/c3ccc(I)cc3)c(O)o2)cc1 |
| InChI | InChI=1S/C20H19IN2O3/c1-2-3-12-25-17-10-4-14(5-11-17)19-23-18(20(24)26-19)13-22-16-8-6-15(21)7-9-16/h4-11,13,24H,2-3,12H2,1H3/b22-13+ |
| InChIKey | NQTXKQNVDZRXFP-LPYMAVHISA-N |
| XLogP | 5.58 |
| TPSA | 67.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.29 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|