C16H15Br2NO2 — CID 114371373
2,5-dibromo-N-[(3-methoxyphenyl)methyl]-N-methylbenzamide (PubChem CID 114371373) has the molecular formula C16H15Br2NO2 and a molecular weight of 413.11 g/mol. Its IUPAC name is 2,5-dibromo-N-[(3-methoxyphenyl)methyl]-N-methylbenzamide.
| Compound Name | 2,5-dibromo-N-[(3-methoxyphenyl)methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 114371373 |
| Molecular Formula | C16H15Br2NO2 |
| Molecular Weight | 413.11 g/mol |
| Exact Mass | 410.95 |
| IUPAC Name | 2,5-dibromo-N-[(3-methoxyphenyl)methyl]-N-methylbenzamide |
| SMILES | COc1cccc(CN(C)C(=O)c2cc(Br)ccc2Br)c1 |
| InChI | InChI=1S/C16H15Br2NO2/c1-19(10-11-4-3-5-13(8-11)21-2)16(20)14-9-12(17)6-7-15(14)18/h3-9H,10H2,1-2H3 |
| InChIKey | UORSJQZKRLQGII-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.11 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |