C15H12Br2ClNO — CID 114370543
2,5-dibromo-N-[(3-chlorophenyl)methyl]-N-methylbenzamide (PubChem CID 114370543) has the molecular formula C15H12Br2ClNO and a molecular weight of 417.53 g/mol. Its IUPAC name is 2,5-dibromo-N-[(3-chlorophenyl)methyl]-N-methylbenzamide.
| Compound Name | 2,5-dibromo-N-[(3-chlorophenyl)methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 114370543 |
| Molecular Formula | C15H12Br2ClNO |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 414.90 |
| IUPAC Name | 2,5-dibromo-N-[(3-chlorophenyl)methyl]-N-methylbenzamide |
| SMILES | CN(Cc1cccc(Cl)c1)C(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C15H12Br2ClNO/c1-19(9-10-3-2-4-12(18)7-10)15(20)13-8-11(16)5-6-14(13)17/h2-8H,9H2,1H3 |
| InChIKey | GFJJKUFGPFXQHW-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |