C15H14Br2N2O — CID 114372600
2,5-dibromo-N-methyl-N-[(6-methyl-2-pyridinyl)methyl]benzamide (PubChem CID 114372600) has the molecular formula C15H14Br2N2O and a molecular weight of 398.10 g/mol. Its IUPAC name is 2,5-dibromo-N-methyl-N-[(6-methyl-2-pyridinyl)methyl]benzamide.
| Compound Name | 2,5-dibromo-N-methyl-N-[(6-methyl-2-pyridinyl)methyl]benzamide |
|---|---|
| PubChem CID | 114372600 |
| Molecular Formula | C15H14Br2N2O |
| Molecular Weight | 398.10 g/mol |
| Exact Mass | 395.95 |
| IUPAC Name | 2,5-dibromo-N-methyl-N-[(6-methyl-2-pyridinyl)methyl]benzamide |
| SMILES | Cc1cccc(CN(C)C(=O)c2cc(Br)ccc2Br)n1 |
| InChI | InChI=1S/C15H14Br2N2O/c1-10-4-3-5-12(18-10)9-19(2)15(20)13-8-11(16)6-7-14(13)17/h3-8H,9H2,1-2H3 |
| InChIKey | FDLSTHVARFICOJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.10 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |