C17H21Br2NO — CID 114372423
2,5-dibromo-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)benzamide (PubChem CID 114372423) has the molecular formula C17H21Br2NO and a molecular weight of 415.17 g/mol. Its IUPAC name is 2,5-dibromo-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)benzamide.
| Compound Name | 2,5-dibromo-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)benzamide |
|---|---|
| PubChem CID | 114372423 |
| Molecular Formula | C17H21Br2NO |
| Molecular Weight | 415.17 g/mol |
| Exact Mass | 413.00 |
| IUPAC Name | 2,5-dibromo-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)benzamide |
| SMILES | CC12CCC(C1)C(C)(C)C2NC(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C17H21Br2NO/c1-16(2)10-6-7-17(3,9-10)15(16)20-14(21)12-8-11(18)4-5-13(12)19/h4-5,8,10,15H,6-7,9H2,1-3H3,(H,20,21) |
| InChIKey | WYYFBYZAHCHJJX-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.17 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |