C15H8Br2FNO — CID 114373103
3-(2,5-dibromophenyl)-2-(2-fluorophenyl)-3-oxopropanenitrile (PubChem CID 114373103) has the molecular formula C15H8Br2FNO and a molecular weight of 397.04 g/mol. Its IUPAC name is 3-(2,5-dibromophenyl)-2-(2-fluorophenyl)-3-oxopropanenitrile.
| Compound Name | 3-(2,5-dibromophenyl)-2-(2-fluorophenyl)-3-oxopropanenitrile |
|---|---|
| PubChem CID | 114373103 |
| Molecular Formula | C15H8Br2FNO |
| Molecular Weight | 397.04 g/mol |
| Exact Mass | 394.90 |
| IUPAC Name | 3-(2,5-dibromophenyl)-2-(2-fluorophenyl)-3-oxopropanenitrile |
| SMILES | N#CC(C(=O)c1cc(Br)ccc1Br)c1ccccc1F |
| InChI | InChI=1S/C15H8Br2FNO/c16-9-5-6-13(17)11(7-9)15(20)12(8-19)10-3-1-2-4-14(10)18/h1-7,12H |
| InChIKey | UQFNNOTXGQQQRR-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.04 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |