C15H7BrClF2NO — CID 82771166
2-(2-bromophenyl)-3-(4-chloro-2,5-difluorophenyl)-3-oxopropanenitrile (PubChem CID 82771166) has the molecular formula C15H7BrClF2NO and a molecular weight of 370.58 g/mol. Its IUPAC name is 2-(2-bromophenyl)-3-(4-chloro-2,5-difluorophenyl)-3-oxopropanenitrile.
| Compound Name | 2-(2-bromophenyl)-3-(4-chloro-2,5-difluorophenyl)-3-oxopropanenitrile |
|---|---|
| PubChem CID | 82771166 |
| Molecular Formula | C15H7BrClF2NO |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 368.94 |
| IUPAC Name | 2-(2-bromophenyl)-3-(4-chloro-2,5-difluorophenyl)-3-oxopropanenitrile |
| SMILES | N#CC(C(=O)c1cc(F)c(Cl)cc1F)c1ccccc1Br |
| InChI | InChI=1S/C15H7BrClF2NO/c16-11-4-2-1-3-8(11)10(7-20)15(21)9-5-14(19)12(17)6-13(9)18/h1-6,10H |
| InChIKey | LURKFISIMKMSSB-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|