2-tert-butyl-4-(2-methylpropyl)-1,3-oxazole-5-carboxylic acid

C12H19NO3 — CID 114374559

IUPAC2-tert-butyl-4-(2-methylpropyl)-1,3-oxazole-5-carboxylic acid
SMILESCC(C)Cc1nc(C(C)(C)C)oc1C(=O)O
InChIInChI=1S/C12H19NO3/c1-7(2)6-8-9(10(14)15)16-11(13-8)12(3,4)5/h7H,6H2,1-5H3,(H,14,15)
InChIKeyZGWQXRDVRMYXLN-UHFFFAOYSA-N
MW225.29 g/mol
LogP2.87
Rot. Bonds3

About 2-tert-butyl-4-(2-methylpropyl)-1,3-oxazole-5-carboxylic acid

2-tert-butyl-4-(2-methylpropyl)-1,3-oxazole-5-carboxylic acid (PubChem CID 114374559) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is 2-tert-butyl-4-(2-methylpropyl)-1,3-oxazole-5-carboxylic acid.

Molecular Properties

Compound Name2-tert-butyl-4-(2-methylpropyl)-1,3-oxazole-5-carboxylic acid
PubChem CID114374559
Molecular FormulaC12H19NO3
Molecular Weight225.29 g/mol
Exact Mass225.14
IUPAC Name2-tert-butyl-4-(2-methylpropyl)-1,3-oxazole-5-carboxylic acid
SMILESCC(C)Cc1nc(C(C)(C)C)oc1C(=O)O
InChIInChI=1S/C12H19NO3/c1-7(2)6-8-9(10(14)15)16-11(13-8)12(3,4)5/h7H,6H2,1-5H3,(H,14,15)
InChIKeyZGWQXRDVRMYXLN-UHFFFAOYSA-N
XLogP2.87
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.29
LogP ≤ 52.87
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-tert-butyl-4-(2-methylpropyl)-1,3-oxazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-tert-butyl-4-(2-methylpropyl)-1,3-oxazole-5-carboxylic acid?
The IUPAC name of 2-tert-butyl-4-(2-methylpropyl)-1,3-oxazole-5-carboxylic acid (CID 114374559) is 2-tert-butyl-4-(2-methylpropyl)-1,3-oxazole-5-carboxylic acid.
What is the SMILES notation for 2-tert-butyl-4-(2-methylpropyl)-1,3-oxazole-5-carboxylic acid?
The canonical SMILES for 2-tert-butyl-4-(2-methylpropyl)-1,3-oxazole-5-carboxylic acid is CC(C)Cc1nc(C(C)(C)C)oc1C(=O)O.
What is the InChIKey of 2-tert-butyl-4-(2-methylpropyl)-1,3-oxazole-5-carboxylic acid?
The InChIKey is ZGWQXRDVRMYXLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO3/c1-7(2)6-8-9(10(14)15)16-11(13-8)12(3,4)5/h7H,6H2,1-5H3,(H,14,15).
What are the key properties of 2-tert-butyl-4-(2-methylpropyl)-1,3-oxazole-5-carboxylic acid?
2-tert-butyl-4-(2-methylpropyl)-1,3-oxazole-5-carboxylic acid has a molecular weight of 225.29 g/mol, XLogP of 2.87, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-4-(2-methylpropyl)-1,3-oxazole-5-carboxylic acid is sourced from PubChem (CID 114374559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).