About 4-(2-methylpropyl)-2-(oxan-4-yl)-1,3-oxazole-5-carboxylic acid
4-(2-methylpropyl)-2-(oxan-4-yl)-1,3-oxazole-5-carboxylic acid (PubChem CID 114374696) has the molecular formula C13H19NO4
and a molecular weight of 253.30 g/mol. Its IUPAC name is 4-(2-methylpropyl)-2-(oxan-4-yl)-1,3-oxazole-5-carboxylic acid.
Analyze 4-(2-methylpropyl)-2-(oxan-4-yl)-1,3-oxazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methylpropyl)-2-(oxan-4-yl)-1,3-oxazole-5-carboxylic acid?
The IUPAC name of 4-(2-methylpropyl)-2-(oxan-4-yl)-1,3-oxazole-5-carboxylic acid (CID 114374696) is 4-(2-methylpropyl)-2-(oxan-4-yl)-1,3-oxazole-5-carboxylic acid.
What is the SMILES notation for 4-(2-methylpropyl)-2-(oxan-4-yl)-1,3-oxazole-5-carboxylic acid?
The canonical SMILES for 4-(2-methylpropyl)-2-(oxan-4-yl)-1,3-oxazole-5-carboxylic acid is CC(C)Cc1nc(C2CCOCC2)oc1C(=O)O.
What is the InChIKey of 4-(2-methylpropyl)-2-(oxan-4-yl)-1,3-oxazole-5-carboxylic acid?
The InChIKey is AXZZVQNSKJFGFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO4/c1-8(2)7-10-11(13(15)16)18-12(14-10)9-3-5-17-6-4-9/h8-9H,3-7H2,1-2H3,(H,15,16).
What are the key properties of 4-(2-methylpropyl)-2-(oxan-4-yl)-1,3-oxazole-5-carboxylic acid?
4-(2-methylpropyl)-2-(oxan-4-yl)-1,3-oxazole-5-carboxylic acid has a molecular weight of 253.30 g/mol, XLogP of 2.47, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methylpropyl)-2-(oxan-4-yl)-1,3-oxazole-5-carboxylic acid is sourced from PubChem (CID 114374696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).