C13H19NO4 — CID 102525599
ethyl 2-[5-methyl-2-(oxan-4-yl)-1,3-oxazol-4-yl]acetate (PubChem CID 102525599) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is ethyl 2-[5-methyl-2-(oxan-4-yl)-1,3-oxazol-4-yl]acetate.
| Compound Name | ethyl 2-[5-methyl-2-(oxan-4-yl)-1,3-oxazol-4-yl]acetate |
|---|---|
| PubChem CID | 102525599 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | ethyl 2-[5-methyl-2-(oxan-4-yl)-1,3-oxazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1nc(C2CCOCC2)oc1C |
| InChI | InChI=1S/C13H19NO4/c1-3-17-12(15)8-11-9(2)18-13(14-11)10-4-6-16-7-5-10/h10H,3-8H2,1-2H3 |
| InChIKey | SSIDWTIUUYPBQW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |