C15H12Br3NO — CID 114375751
2,5-dibromo-N-(2-bromo-2-phenylethyl)benzamide (PubChem CID 114375751) has the molecular formula C15H12Br3NO and a molecular weight of 461.98 g/mol. Its IUPAC name is 2,5-dibromo-N-(2-bromo-2-phenylethyl)benzamide.
| Compound Name | 2,5-dibromo-N-(2-bromo-2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 114375751 |
| Molecular Formula | C15H12Br3NO |
| Molecular Weight | 461.98 g/mol |
| Exact Mass | 458.85 |
| IUPAC Name | 2,5-dibromo-N-(2-bromo-2-phenylethyl)benzamide |
| SMILES | O=C(NCC(Br)c1ccccc1)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C15H12Br3NO/c16-11-6-7-13(17)12(8-11)15(20)19-9-14(18)10-4-2-1-3-5-10/h1-8,14H,9H2,(H,19,20) |
| InChIKey | PHUWYHXCWOYDGJ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.98 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|