C19H26O2 — CID 11437645
(1R,9S)-9-methoxy-12,15,15-trimethyltricyclo[9.3.1.03,8]pentadeca-3(8),5,11-trien-2-one (PubChem CID 11437645) has the molecular formula C19H26O2 and a molecular weight of 286.41 g/mol. Its IUPAC name is (1R,9S)-9-methoxy-12,15,15-trimethyltricyclo[9.3.1.03,8]pentadeca-3(8),5,11-trien-2-one.
| Compound Name | (1R,9S)-9-methoxy-12,15,15-trimethyltricyclo[9.3.1.03,8]pentadeca-3(8),5,11-trien-2-one |
|---|---|
| PubChem CID | 11437645 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | (1R,9S)-9-methoxy-12,15,15-trimethyltricyclo[9.3.1.03,8]pentadeca-3(8),5,11-trien-2-one |
| SMILES | CO[C@H]1CC2=C(C)CC[C@@H](C(=O)C3=C1CC=CC3)C2(C)C |
| InChI | InChI=1S/C19H26O2/c1-12-9-10-15-18(20)14-8-6-5-7-13(14)17(21-4)11-16(12)19(15,2)3/h5-6,15,17H,7-11H2,1-4H3/t15-,17-/m0/s1 |
| InChIKey | UUZSXANVRBWRIA-RDJZCZTQSA-N |
| XLogP | 4.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|